C24H20Cl2N2O4 — CID 44791031
[4-[(E)-[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]phenyl] benzoate (PubChem CID 44791031) has the molecular formula C24H20Cl2N2O4 and a molecular weight of 471.34 g/mol. Its IUPAC name is [4-[(E)-[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(E)-[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 44791031 |
| Molecular Formula | C24H20Cl2N2O4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [4-[(E)-[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)N/N=C/c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20Cl2N2O4/c25-19-10-13-22(21(26)15-19)31-14-4-7-23(29)28-27-16-17-8-11-20(12-9-17)32-24(30)18-5-2-1-3-6-18/h1-3,5-6,8-13,15-16H,4,7,14H2,(H,28,29)/b27-16+ |
| InChIKey | HEJBSUXWHCLPGQ-JVWAILMASA-N |
| XLogP | 5.52 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|