C25H21Cl3N2O5 — CID 4636100
[4-[[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate (PubChem CID 4636100) has the molecular formula C25H21Cl3N2O5 and a molecular weight of 535.81 g/mol. Its IUPAC name is [4-[[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4636100 |
| Molecular Formula | C25H21Cl3N2O5 |
| Molecular Weight | 535.81 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | [4-[[4-(2,4-dichlorophenoxy)butanoylhydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)CCCOc2ccc(Cl)cc2Cl)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H21Cl3N2O5/c1-33-23-13-16(8-10-22(23)35-25(32)18-5-2-3-6-19(18)27)15-29-30-24(31)7-4-12-34-21-11-9-17(26)14-20(21)28/h2-3,5-6,8-11,13-15H,4,7,12H2,1H3,(H,30,31) |
| InChIKey | RWBYAWAQWXRPLQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|