C18H17Cl3N2O4 — CID 135609327
N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 135609327) has the molecular formula C18H17Cl3N2O4 and a molecular weight of 431.70 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 135609327 |
| Molecular Formula | C18H17Cl3N2O4 |
| Molecular Weight | 431.70 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | COc1cc(/C=N/NC(=O)CCCOc2ccc(Cl)cc2Cl)cc(Cl)c1O |
| InChI | InChI=1S/C18H17Cl3N2O4/c1-26-16-8-11(7-14(21)18(16)25)10-22-23-17(24)3-2-6-27-15-5-4-12(19)9-13(15)20/h4-5,7-10,25H,2-3,6H2,1H3,(H,23,24)/b22-10+ |
| InChIKey | SMGXKTNBCHCRGX-LSHDLFTRSA-N |
| XLogP | 4.67 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|