C21H20Cl2N2O4 — CID 4272633
4-(2,4-dichlorophenoxy)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]butanamide (PubChem CID 4272633) has the molecular formula C21H20Cl2N2O4 and a molecular weight of 435.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 4272633 |
| Molecular Formula | C21H20Cl2N2O4 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylideneamino]butanamide |
| SMILES | C#CCOc1c(C=NNC(=O)CCCOc2ccc(Cl)cc2Cl)cccc1OC |
| InChI | InChI=1S/C21H20Cl2N2O4/c1-3-11-29-21-15(6-4-7-19(21)27-2)14-24-25-20(26)8-5-12-28-18-10-9-16(22)13-17(18)23/h1,4,6-7,9-10,13-14H,5,8,11-12H2,2H3,(H,25,26) |
| InChIKey | CGUNBAYRSKSHNF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|