C30H28BrCl2N3O5 — CID 126018702
N-[(2R)-1-[(2Z)-2-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 126018702) has the molecular formula C30H28BrCl2N3O5 and a molecular weight of 661.38 g/mol. Its IUPAC name is N-[(2R)-1-[(2Z)-2-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[(2R)-1-[(2Z)-2-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 126018702 |
| Molecular Formula | C30H28BrCl2N3O5 |
| Molecular Weight | 661.38 g/mol |
| Exact Mass | 659.06 |
| IUPAC Name | N-[(2R)-1-[(2Z)-2-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | C#CCOc1c(Br)cc(/C=N\NC(=O)[C@@H](Cc2ccccc2)NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C30H28BrCl2N3O5/c1-3-13-41-29-23(31)15-21(17-27(29)39-2)19-34-36-30(38)25(16-20-8-5-4-6-9-20)35-28(37)10-7-14-40-26-12-11-22(32)18-24(26)33/h1,4-6,8-9,11-12,15,17-19,25H,7,10,13-14,16H2,2H3,(H,35,37)(H,36,38)/b34-19-/t25-/m1/s1 |
| InChIKey | HOADQWAYPAFNFA-BZEHSJIPSA-N |
| XLogP | 5.81 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|