C26H24BrCl2N3O5 — CID 137051493
(2R)-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide (PubChem CID 137051493) has the molecular formula C26H24BrCl2N3O5 and a molecular weight of 609.30 g/mol. Its IUPAC name is (2R)-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 137051493 |
| Molecular Formula | C26H24BrCl2N3O5 |
| Molecular Weight | 609.30 g/mol |
| Exact Mass | 607.03 |
| IUPAC Name | (2R)-N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-phenylpropanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)cc(Br)c1O |
| InChI | InChI=1S/C26H24BrCl2N3O5/c1-15(37-22-9-8-18(28)13-20(22)29)25(34)31-21(11-16-6-4-3-5-7-16)26(35)32-30-14-17-10-19(27)24(33)23(12-17)36-2/h3-10,12-15,21,33H,11H2,1-2H3,(H,31,34)(H,32,35)/b30-14-/t15-,21-/m1/s1 |
| InChIKey | XDHFXSQJIXODNU-GRVXCNMHSA-N |
| XLogP | 5.12 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|