C25H31Cl2N3O6 — CID 126024856
(2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide (PubChem CID 126024856) has the molecular formula C25H31Cl2N3O6 and a molecular weight of 540.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 126024856 |
| Molecular Formula | C25H31Cl2N3O6 |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C25H31Cl2N3O6/c1-14(2)9-19(29-24(31)15(3)36-20-8-7-17(26)12-18(20)27)25(32)30-28-13-16-10-21(33-4)23(35-6)22(11-16)34-5/h7-8,10-15,19H,9H2,1-6H3,(H,29,31)(H,30,32)/b28-13-/t15-,19-/m0/s1 |
| InChIKey | UFQOGYDKBIWMKI-IARFJXFDSA-N |
| XLogP | 4.47 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|