C32H37Cl2N3O5 — CID 126021706
(2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide (PubChem CID 126021706) has the molecular formula C32H37Cl2N3O5 and a molecular weight of 614.57 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126021706 |
| Molecular Formula | C32H37Cl2N3O5 |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | (2S)-2-[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]-N-[(Z)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4-methylpentanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C32H37Cl2N3O5/c1-6-40-30-16-23(10-12-29(30)41-19-24-9-7-8-21(4)15-24)18-35-37-32(39)27(14-20(2)3)36-31(38)22(5)42-28-13-11-25(33)17-26(28)34/h7-13,15-18,20,22,27H,6,14,19H2,1-5H3,(H,36,38)(H,37,39)/b35-18-/t22-,27+/m1/s1 |
| InChIKey | NWDKPIWRADWFDR-ZYYVSLSMSA-N |
| XLogP | 6.73 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|