C29H31Cl2N3O4 — CID 5109361
4-chloro-N-[1-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 5109361) has the molecular formula C29H31Cl2N3O4 and a molecular weight of 556.49 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 5109361 |
| Molecular Formula | C29H31Cl2N3O4 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 4-chloro-N-[1-[2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCOc1cc(C=NNC(=O)C(CC(C)C)NC(=O)c2ccc(Cl)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H31Cl2N3O4/c1-4-37-27-16-21(7-14-26(27)38-18-20-5-10-23(30)11-6-20)17-32-34-29(36)25(15-19(2)3)33-28(35)22-8-12-24(31)13-9-22/h5-14,16-17,19,25H,4,15,18H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | ZYIXYIRMUNOTOV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|