C24H27BrClN3O5 — CID 4041554
ethyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 4041554) has the molecular formula C24H27BrClN3O5 and a molecular weight of 552.85 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4041554 |
| Molecular Formula | C24H27BrClN3O5 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | ethyl 2-[2-bromo-4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=NNC(=O)C(CC(C)C)NC(=O)c2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C24H27BrClN3O5/c1-4-33-22(30)14-34-21-10-5-16(12-19(21)25)13-27-29-24(32)20(11-15(2)3)28-23(31)17-6-8-18(26)9-7-17/h5-10,12-13,15,20H,4,11,14H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | VBONUJMBVHSHEF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|