C27H26Cl3N3O3 — CID 3599501
4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 3599501) has the molecular formula C27H26Cl3N3O3 and a molecular weight of 546.88 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 3599501 |
| Molecular Formula | C27H26Cl3N3O3 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1)C(=O)NN=Cc1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C27H26Cl3N3O3/c1-17(2)13-25(32-26(34)19-5-8-21(28)9-6-19)27(35)33-31-15-18-3-11-23(12-4-18)36-16-20-7-10-22(29)14-24(20)30/h3-12,14-15,17,25H,13,16H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | SFNTUHHJYQLHHE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|