C27H25BrCl3N3O3 — CID 4661949
N-[1-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-chlorobenzamide (PubChem CID 4661949) has the molecular formula C27H25BrCl3N3O3 and a molecular weight of 625.78 g/mol. Its IUPAC name is N-[1-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 4661949 |
| Molecular Formula | C27H25BrCl3N3O3 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 623.01 |
| IUPAC Name | N-[1-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-4-chlorobenzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1)C(=O)NN=Cc1ccc(OCc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C27H25BrCl3N3O3/c1-16(2)11-24(33-26(35)18-4-7-20(29)8-5-18)27(36)34-32-14-17-3-10-25(22(28)12-17)37-15-19-6-9-21(30)13-23(19)31/h3-10,12-14,16,24H,11,15H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | FFMYAULEAQBYRO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|