C28H28Cl3N3O4 — CID 3962023
4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 3962023) has the molecular formula C28H28Cl3N3O4 and a molecular weight of 576.91 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 3962023 |
| Molecular Formula | C28H28Cl3N3O4 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | 4-chloro-N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | COc1cc(C=NNC(=O)C(CC(C)C)NC(=O)c2ccc(Cl)cc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H28Cl3N3O4/c1-17(2)12-24(33-27(35)19-5-8-21(29)9-6-19)28(36)34-32-15-18-4-11-25(26(13-18)37-3)38-16-20-7-10-22(30)14-23(20)31/h4-11,13-15,17,24H,12,16H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | DUGMNRBXTLOAJC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|