C26H25Cl2N3O5 — CID 3428521
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide (PubChem CID 3428521) has the molecular formula C26H25Cl2N3O5 and a molecular weight of 530.41 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 3428521 |
| Molecular Formula | C26H25Cl2N3O5 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C)C(=O)NN=Cc2ccc(OCc3ccc(Cl)cc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O5/c1-16(25(32)30-20-7-9-21(34-2)10-8-20)26(33)31-29-14-17-4-11-23(24(12-17)35-3)36-15-18-5-6-19(27)13-22(18)28/h4-14,16H,15H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | WPWZIEBIUFYTRU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|