C22H19Cl2N3O2S — CID 6258926
1-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-phenylthiourea (PubChem CID 6258926) has the molecular formula C22H19Cl2N3O2S and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 6258926 |
| Molecular Formula | C22H19Cl2N3O2S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 1-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-phenylthiourea |
| SMILES | COc1cc(/C=N\NC(=S)Nc2ccccc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H19Cl2N3O2S/c1-28-21-11-15(13-25-27-22(30)26-18-5-3-2-4-6-18)7-10-20(21)29-14-16-8-9-17(23)12-19(16)24/h2-13H,14H2,1H3,(H2,26,27,30)/b25-13- |
| InChIKey | PLAKSZFQDNYSDF-MXAYSNPKSA-N |
| XLogP | 5.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|