C23H23N3O3S — CID 3403328
1-(4-methoxyphenyl)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]thiourea (PubChem CID 3403328) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3403328 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(NC(=S)NN=Cc2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-27-20-11-9-19(10-12-20)25-23(30)26-24-15-18-8-13-21(22(14-18)28-2)29-16-17-6-4-3-5-7-17/h3-15H,16H2,1-2H3,(H2,25,26,30) |
| InChIKey | ISBSXUYQEOORJM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|