C21H19ClN4O2S — CID 5141407
1-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-pyridin-3-ylthiourea (PubChem CID 5141407) has the molecular formula C21H19ClN4O2S and a molecular weight of 426.93 g/mol. Its IUPAC name is 1-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 5141407 |
| Molecular Formula | C21H19ClN4O2S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-pyridin-3-ylthiourea |
| SMILES | COc1cc(C=NNC(=S)Nc2cccnc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN4O2S/c1-27-20-11-16(12-24-26-21(29)25-18-3-2-10-23-13-18)6-9-19(20)28-14-15-4-7-17(22)8-5-15/h2-13H,14H2,1H3,(H2,25,26,29) |
| InChIKey | ZIKBMAXPNOVSLH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|