C23H23ClN2O2 — CID 110841045
N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3,4-dimethylaniline (PubChem CID 110841045) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110841045 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3,4-dimethylaniline |
| SMILES | COc1cc(C=NNc2ccc(C)c(C)c2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O2/c1-16-4-10-21(12-17(16)2)26-25-14-19-7-11-22(23(13-19)27-3)28-15-18-5-8-20(24)9-6-18/h4-14,26H,15H2,1-3H3 |
| InChIKey | AYKZALITTXIODS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|