C23H21Cl3N2O2 — CID 110840998
N-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline (PubChem CID 110840998) has the molecular formula C23H21Cl3N2O2 and a molecular weight of 463.79 g/mol. Its IUPAC name is N-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110840998 |
| Molecular Formula | C23H21Cl3N2O2 |
| Molecular Weight | 463.79 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-[[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
| SMILES | COc1cc(C=NNc2ccc(C)c(C)c2)ccc1OCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C23H21Cl3N2O2/c1-14-4-6-17(10-15(14)2)28-27-12-16-5-9-21(22(11-16)29-3)30-13-18-19(24)7-8-20(25)23(18)26/h4-12,28H,13H2,1-3H3 |
| InChIKey | YTUFRWJRTIKMEZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.79 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|