C18H21ClN2O3 — CID 110505280
3-chloro-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-4-methoxyaniline (PubChem CID 110505280) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 3-chloro-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-4-methoxyaniline.
| Compound Name | 3-chloro-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-4-methoxyaniline |
|---|---|
| PubChem CID | 110505280 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-chloro-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-4-methoxyaniline |
| SMILES | CCOc1ccc(/C=N/Nc2ccc(OC)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C18H21ClN2O3/c1-4-23-17-8-6-13(10-18(17)24-5-2)12-20-21-14-7-9-16(22-3)15(19)11-14/h6-12,21H,4-5H2,1-3H3/b20-12+ |
| InChIKey | AAPATUKZLUFGEY-UDWIEESQSA-N |
| XLogP | 4.59 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|