C20H25ClN2O2 — CID 110506495
N-[(E)-(4-butoxy-3-ethoxyphenyl)methylideneamino]-3-chloro-4-methylaniline (PubChem CID 110506495) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is N-[(E)-(4-butoxy-3-ethoxyphenyl)methylideneamino]-3-chloro-4-methylaniline.
| Compound Name | N-[(E)-(4-butoxy-3-ethoxyphenyl)methylideneamino]-3-chloro-4-methylaniline |
|---|---|
| PubChem CID | 110506495 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(E)-(4-butoxy-3-ethoxyphenyl)methylideneamino]-3-chloro-4-methylaniline |
| SMILES | CCCCOc1ccc(/C=N/Nc2ccc(C)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C20H25ClN2O2/c1-4-6-11-25-19-10-8-16(12-20(19)24-5-2)14-22-23-17-9-7-15(3)18(21)13-17/h7-10,12-14,23H,4-6,11H2,1-3H3/b22-14+ |
| InChIKey | ZIZUSMWLKKMRGR-HYARGMPZSA-N |
| XLogP | 5.67 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|