C22H19Cl3N2O2 — CID 110840523
3,4-dichloro-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]aniline (PubChem CID 110840523) has the molecular formula C22H19Cl3N2O2 and a molecular weight of 449.77 g/mol. Its IUPAC name is 3,4-dichloro-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110840523 |
| Molecular Formula | C22H19Cl3N2O2 |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 3,4-dichloro-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]aniline |
| SMILES | CCOc1cc(C=NNc2ccc(Cl)c(Cl)c2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19Cl3N2O2/c1-2-28-22-11-16(13-26-27-18-8-9-19(24)20(25)12-18)5-10-21(22)29-14-15-3-6-17(23)7-4-15/h3-13,27H,2,14H2,1H3 |
| InChIKey | GUHKONSSJMJQCI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|