C21H16Cl4N2O2 — CID 110840463
3,4-dichloro-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline (PubChem CID 110840463) has the molecular formula C21H16Cl4N2O2 and a molecular weight of 470.18 g/mol. Its IUPAC name is 3,4-dichloro-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110840463 |
| Molecular Formula | C21H16Cl4N2O2 |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 3,4-dichloro-N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline |
| SMILES | COc1cc(C=NNc2ccc(Cl)c(Cl)c2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl4N2O2/c1-28-21-9-13(11-26-27-15-4-6-17(23)19(25)10-15)3-7-20(21)29-12-14-2-5-16(22)18(24)8-14/h2-11,27H,12H2,1H3 |
| InChIKey | WZKJANHSWDPGFQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|