C23H20Cl2N2O4 — CID 110515524
N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(4-hydroxyphenyl)acetamide (PubChem CID 110515524) has the molecular formula C23H20Cl2N2O4 and a molecular weight of 459.33 g/mol. Its IUPAC name is N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 110515524 |
| Molecular Formula | C23H20Cl2N2O4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(4-hydroxyphenyl)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2ccc(O)cc2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H20Cl2N2O4/c1-30-22-11-16(13-26-27-23(29)12-15-2-6-18(28)7-3-15)5-9-21(22)31-14-17-4-8-19(24)20(25)10-17/h2-11,13,28H,12,14H2,1H3,(H,27,29)/b26-13- |
| InChIKey | DHGJTBMXLOFZLZ-ZMFRSBBQSA-N |
| XLogP | 4.98 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|