C22H20Cl2N2O3S — CID 126212779
N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-thiophen-2-ylacetamide (PubChem CID 126212779) has the molecular formula C22H20Cl2N2O3S and a molecular weight of 463.39 g/mol. Its IUPAC name is N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 126212779 |
| Molecular Formula | C22H20Cl2N2O3S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-thiophen-2-ylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2cccs2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N2O3S/c1-2-28-21-11-15(13-25-26-22(27)12-17-4-3-9-30-17)6-8-20(21)29-14-16-5-7-18(23)19(24)10-16/h3-11,13H,2,12,14H2,1H3,(H,26,27)/b25-13- |
| InChIKey | PLEQYVNYGBLNKM-MXAYSNPKSA-N |
| XLogP | 5.73 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|