C28H23Cl2N3O4S — CID 126162166
N-[2-[[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 126162166) has the molecular formula C28H23Cl2N3O4S and a molecular weight of 568.48 g/mol. Its IUPAC name is N-[2-[[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126162166 |
| Molecular Formula | C28H23Cl2N3O4S |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | N-[2-[[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccccc2NC(=O)c2cccs2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H23Cl2N3O4S/c1-2-36-25-15-18(10-12-24(25)37-17-19-9-11-21(29)22(30)14-19)16-31-33-27(34)20-6-3-4-7-23(20)32-28(35)26-8-5-13-38-26/h3-16H,2,17H2,1H3,(H,32,35)(H,33,34)/b31-16- |
| InChIKey | RIBKQAVVYDPEIR-ACXHZZMFSA-N |
| XLogP | 7.05 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|