C27H23N3O4S — CID 94831805
N-[2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 94831805) has the molecular formula C27H23N3O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 94831805 |
| Molecular Formula | C27H23N3O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[2-[[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccccc2NC(=O)c2cccs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H23N3O4S/c1-33-24-16-20(13-14-23(24)34-18-19-8-3-2-4-9-19)17-28-30-26(31)21-10-5-6-11-22(21)29-27(32)25-12-7-15-35-25/h2-17H,18H2,1H3,(H,29,32)(H,30,31)/b28-17- |
| InChIKey | ROYGSYZIEQNNLC-QRQIAZFYSA-N |
| XLogP | 5.35 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|