C22H20N2O5 — CID 17126913
2,5-dihydroxy-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide (PubChem CID 17126913) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2,5-dihydroxy-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2,5-dihydroxy-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 17126913 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2,5-dihydroxy-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(O)ccc2O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H20N2O5/c1-28-21-11-16(7-10-20(21)29-14-15-5-3-2-4-6-15)13-23-24-22(27)18-12-17(25)8-9-19(18)26/h2-13,25-26H,14H2,1H3,(H,24,27)/b23-13+ |
| InChIKey | WLOMNUORGSCDJI-YDZHTSKRSA-N |
| XLogP | 3.45 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|