C26H21ClN2O4 — CID 6092862
N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 6092862) has the molecular formula C26H21ClN2O4 and a molecular weight of 460.92 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 6092862 |
| Molecular Formula | C26H21ClN2O4 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3ccccc3cc2O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21ClN2O4/c1-32-25-12-18(8-11-24(25)33-16-17-6-9-21(27)10-7-17)15-28-29-26(31)22-13-19-4-2-3-5-20(19)14-23(22)30/h2-15,30H,16H2,1H3,(H,29,31)/b28-15- |
| InChIKey | JTWHZCJPTYNZDD-MBTHVWNTSA-N |
| XLogP | 5.55 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|