C23H21Cl2N3O2S — CID 4278393
1-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylthiourea (PubChem CID 4278393) has the molecular formula C23H21Cl2N3O2S and a molecular weight of 474.41 g/mol. Its IUPAC name is 1-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 4278393 |
| Molecular Formula | C23H21Cl2N3O2S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 1-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-phenylthiourea |
| SMILES | CCOc1cc(C=NNC(=S)Nc2ccccc2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2N3O2S/c1-2-29-22-13-16(14-26-28-23(31)27-18-6-4-3-5-7-18)9-11-21(22)30-15-17-8-10-19(24)20(25)12-17/h3-14H,2,15H2,1H3,(H2,27,28,31) |
| InChIKey | IVWNOCJSMUNBGB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|