C19H19Cl2N3O2S — CID 4607949
1-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea (PubChem CID 4607949) has the molecular formula C19H19Cl2N3O2S and a molecular weight of 424.35 g/mol. Its IUPAC name is 1-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4607949 |
| Molecular Formula | C19H19Cl2N3O2S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 1-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NN=Cc1ccc(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C19H19Cl2N3O2S/c1-3-8-22-19(27)24-23-11-13-5-7-17(18(10-13)25-2)26-12-14-4-6-15(20)16(21)9-14/h3-7,9-11H,1,8,12H2,2H3,(H2,22,24,27) |
| InChIKey | GICXWYQSENUUJZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|