C28H28Cl3N3O4 — CID 126158323
N-(3-chloro-2-methylphenyl)-N'-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]pentanediamide (PubChem CID 126158323) has the molecular formula C28H28Cl3N3O4 and a molecular weight of 576.91 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]pentanediamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 126158323 |
| Molecular Formula | C28H28Cl3N3O4 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]pentanediamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CCCC(=O)Nc2cccc(Cl)c2C)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H28Cl3N3O4/c1-3-37-26-15-19(11-13-25(26)38-17-20-10-12-22(30)23(31)14-20)16-32-34-28(36)9-5-8-27(35)33-24-7-4-6-21(29)18(24)2/h4,6-7,10-16H,3,5,8-9,17H2,1-2H3,(H,33,35)(H,34,36)/b32-16- |
| InChIKey | JGZYBSGJDWYIJE-ZMGVVAQMSA-N |
| XLogP | 7.19 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|