C27H33ClN4O6 — CID 126168992
N-(3-chloro-2-methylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]pentanediamide (PubChem CID 126168992) has the molecular formula C27H33ClN4O6 and a molecular weight of 545.04 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]pentanediamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 126168992 |
| Molecular Formula | C27H33ClN4O6 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]pentanediamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CCCC(=O)Nc2cccc(Cl)c2C)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H33ClN4O6/c1-3-37-24-16-20(10-11-23(24)38-18-27(35)32-12-14-36-15-13-32)17-29-31-26(34)9-5-8-25(33)30-22-7-4-6-21(28)19(22)2/h4,6-7,10-11,16-17H,3,5,8-9,12-15,18H2,1-2H3,(H,30,33)(H,31,34)/b29-17- |
| InChIKey | HDZUCCNGGWMWFE-RHANQZHGSA-N |
| XLogP | 3.54 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|