C25H31N3O6 — CID 5007118
ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate (PubChem CID 5007118) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 5007118 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=NNC(=O)CCC(=O)Nc2cccc(C)c2C)cc1OCC |
| InChI | InChI=1S/C25H31N3O6/c1-5-32-22-14-19(10-11-21(22)34-16-25(31)33-6-2)15-26-28-24(30)13-12-23(29)27-20-9-7-8-17(3)18(20)4/h7-11,14-15H,5-6,12-13,16H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | UDKDQEBPQPANSM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|