C24H31N3O4 — CID 3901107
N-(2,3-dimethylphenyl)-N'-[(3-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]butanediamide (PubChem CID 3901107) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N'-[(3-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]butanediamide.
| Compound Name | N-(2,3-dimethylphenyl)-N'-[(3-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3901107 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N'-[(3-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]butanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CCC(=O)Nc2cccc(C)c2C)ccc1OC(C)C |
| InChI | InChI=1S/C24H31N3O4/c1-6-30-22-14-19(10-11-21(22)31-16(2)3)15-25-27-24(29)13-12-23(28)26-20-9-7-8-17(4)18(20)5/h7-11,14-16H,6,12-13H2,1-5H3,(H,26,28)(H,27,29) |
| InChIKey | XWTYOJKOVCYARM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|