C24H28IN3O6 — CID 3376080
ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 3376080) has the molecular formula C24H28IN3O6 and a molecular weight of 581.41 g/mol. Its IUPAC name is ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3376080 |
| Molecular Formula | C24H28IN3O6 |
| Molecular Weight | 581.41 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | ethyl 2-[4-[[[4-(2,3-dimethylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=NNC(=O)CCC(=O)Nc2cccc(C)c2C)cc1OC |
| InChI | InChI=1S/C24H28IN3O6/c1-5-33-23(31)14-34-24-18(25)11-17(12-20(24)32-4)13-26-28-22(30)10-9-21(29)27-19-8-6-7-15(2)16(19)3/h6-8,11-13H,5,9-10,14H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | WDCNVBMWZDJKNQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|