C22H21F3IN3O6 — CID 3425498
ethyl 2-[2-iodo-6-methoxy-4-[[[3-oxo-3-[3-(trifluoromethyl)anilino]propanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3425498) has the molecular formula C22H21F3IN3O6 and a molecular weight of 607.32 g/mol. Its IUPAC name is ethyl 2-[2-iodo-6-methoxy-4-[[[3-oxo-3-[3-(trifluoromethyl)anilino]propanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-iodo-6-methoxy-4-[[[3-oxo-3-[3-(trifluoromethyl)anilino]propanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3425498 |
| Molecular Formula | C22H21F3IN3O6 |
| Molecular Weight | 607.32 g/mol |
| Exact Mass | 607.04 |
| IUPAC Name | ethyl 2-[2-iodo-6-methoxy-4-[[[3-oxo-3-[3-(trifluoromethyl)anilino]propanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=NNC(=O)CC(=O)Nc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C22H21F3IN3O6/c1-3-34-20(32)12-35-21-16(26)7-13(8-17(21)33-2)11-27-29-19(31)10-18(30)28-15-6-4-5-14(9-15)22(23,24)25/h4-9,11H,3,10,12H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | KKBHIAPCSMHXQL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|