C27H24F3IN4O5 — CID 126175276
N-(2-ethylphenyl)-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126175276) has the molecular formula C27H24F3IN4O5 and a molecular weight of 668.41 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(2-ethylphenyl)-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126175276 |
| Molecular Formula | C27H24F3IN4O5 |
| Molecular Weight | 668.41 g/mol |
| Exact Mass | 668.07 |
| IUPAC Name | N-(2-ethylphenyl)-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)N/N=C\c1cc(I)c(OCC(=O)Nc2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C27H24F3IN4O5/c1-3-17-7-4-5-10-21(17)34-25(37)26(38)35-32-14-16-11-20(31)24(22(12-16)39-2)40-15-23(36)33-19-9-6-8-18(13-19)27(28,29)30/h4-14H,3,15H2,1-2H3,(H,33,36)(H,34,37)(H,35,38)/b32-14- |
| InChIKey | OPMIHCFFIGWOCT-LPEPFOFCSA-N |
| XLogP | 4.99 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|