C27H26ClIN4O5 — CID 126163990
N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide (PubChem CID 126163990) has the molecular formula C27H26ClIN4O5 and a molecular weight of 648.89 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 126163990 |
| Molecular Formula | C27H26ClIN4O5 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.06 |
| IUPAC Name | N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-ethylphenyl)oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)N/N=C\c1cc(I)c(OCC(=O)Nc2ccc(C)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C27H26ClIN4O5/c1-4-18-7-5-6-8-22(18)32-26(35)27(36)33-30-14-17-11-21(29)25(23(12-17)37-3)38-15-24(34)31-19-10-9-16(2)20(28)13-19/h5-14H,4,15H2,1-3H3,(H,31,34)(H,32,35)(H,33,36)/b30-14- |
| InChIKey | NGSKPKFJAXDLFZ-CPDSRJINSA-N |
| XLogP | 4.93 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|