C24H26ClIN4O6 — CID 126167315
N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 126167315) has the molecular formula C24H26ClIN4O6 and a molecular weight of 628.85 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126167315 |
| Molecular Formula | C24H26ClIN4O6 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.06 |
| IUPAC Name | N'-[(Z)-[4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC[C@H]2CCCO2)cc(I)c1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C24H26ClIN4O6/c1-14-5-6-16(10-18(14)25)29-21(31)13-36-22-19(26)8-15(9-20(22)34-2)11-28-30-24(33)23(32)27-12-17-4-3-7-35-17/h5-6,8-11,17H,3-4,7,12-13H2,1-2H3,(H,27,32)(H,29,31)(H,30,33)/b28-11-/t17-/m1/s1 |
| InChIKey | SQYHKXYDOULTIH-OWBRTWHPSA-N |
| XLogP | 3.02 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|