C23H24Cl2N4O6 — CID 126266827
N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 126266827) has the molecular formula C23H24Cl2N4O6 and a molecular weight of 523.37 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126266827 |
| Molecular Formula | C23H24Cl2N4O6 |
| Molecular Weight | 523.37 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC[C@H]2CCCO2)cc(Cl)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H24Cl2N4O6/c1-33-19-10-14(11-27-29-23(32)22(31)26-12-15-5-4-8-34-15)9-17(25)21(19)35-13-20(30)28-18-7-3-2-6-16(18)24/h2-3,6-7,9-11,15H,4-5,8,12-13H2,1H3,(H,26,31)(H,28,30)(H,29,32)/b27-11-/t15-/m1/s1 |
| InChIKey | UEJKMFIDKXZAEG-MNCHIJJASA-N |
| XLogP | 2.76 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|