C17H23N3O6 — CID 7031870
N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxamide (PubChem CID 7031870) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 7031870 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-N'-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC[C@@H]2CCCO2)cc(OC)c1OC |
| InChI | InChI=1S/C17H23N3O6/c1-23-13-7-11(8-14(24-2)15(13)25-3)9-19-20-17(22)16(21)18-10-12-5-4-6-26-12/h7-9,12H,4-6,10H2,1-3H3,(H,18,21)(H,20,22)/b19-9-/t12-/m0/s1 |
| InChIKey | LBMHDAWXKZYFGL-AOPUEWEHSA-N |
| XLogP | 0.46 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|