C21H27BrN4O7 — CID 126273808
N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 126273808) has the molecular formula C21H27BrN4O7 and a molecular weight of 527.37 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126273808 |
| Molecular Formula | C21H27BrN4O7 |
| Molecular Weight | 527.37 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC[C@@H]2CCCO2)cc(Br)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H27BrN4O7/c1-30-17-10-14(11-24-25-21(29)20(28)23-12-15-3-2-6-32-15)9-16(22)19(17)33-13-18(27)26-4-7-31-8-5-26/h9-11,15H,2-8,12-13H2,1H3,(H,23,28)(H,25,29)/b24-11-/t15-/m0/s1 |
| InChIKey | WRBLLENDAMMWFH-PGRIZOJTSA-N |
| XLogP | 0.44 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|