C22H29IN4O6 — CID 126161018
N'-[(Z)-[3-ethoxy-5-iodo-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 126161018) has the molecular formula C22H29IN4O6 and a molecular weight of 572.40 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-5-iodo-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-5-iodo-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126161018 |
| Molecular Formula | C22H29IN4O6 |
| Molecular Weight | 572.40 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-5-iodo-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NC[C@H]2CCCO2)cc(I)c1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H29IN4O6/c1-2-31-18-11-15(10-17(23)20(18)33-14-19(28)27-7-3-4-8-27)12-25-26-22(30)21(29)24-13-16-6-5-9-32-16/h10-12,16H,2-9,13-14H2,1H3,(H,24,29)(H,26,30)/b25-12-/t16-/m1/s1 |
| InChIKey | PSPDNLFKEPXMMD-YQWDGLBASA-N |
| XLogP | 1.44 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|