C17H20N3O6- — CID 8897659
2-ethoxy-5-[(Z)-[[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 8897659) has the molecular formula C17H20N3O6- and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-ethoxy-5-[(Z)-[[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 2-ethoxy-5-[(Z)-[[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8897659 |
| Molecular Formula | C17H20N3O6- |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-ethoxy-5-[(Z)-[[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | CCOc1ccc(/C=N\NC(=O)C(=O)NC[C@@H]2CCCO2)cc1C(=O)[O-] |
| InChI | InChI=1S/C17H21N3O6/c1-2-25-14-6-5-11(8-13(14)17(23)24)9-19-20-16(22)15(21)18-10-12-4-3-7-26-12/h5-6,8-9,12H,2-4,7,10H2,1H3,(H,18,21)(H,20,22)(H,23,24)/p-1/b19-9-/t12-/m0/s1 |
| InChIKey | MHCHHIYZMSTTOF-AOPUEWEHSA-M |
| XLogP | -0.81 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|