C17H22N4O6 — CID 8990291
N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 8990291) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 8990291 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC[C@H]2CCCO2)ccc1OCC(N)=O |
| InChI | InChI=1S/C17H22N4O6/c1-25-14-7-11(4-5-13(14)27-10-15(18)22)8-20-21-17(24)16(23)19-9-12-3-2-6-26-12/h4-5,7-8,12H,2-3,6,9-10H2,1H3,(H2,18,22)(H,19,23)(H,21,24)/b20-8-/t12-/m1/s1 |
| InChIKey | ZHLCCXQIWNHEGQ-JPTRRLIOSA-N |
| XLogP | -0.70 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|