C16H20N4O5 — CID 8990330
N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 8990330) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 8990330 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | NC(=O)COc1cccc(/C=N\NC(=O)C(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C16H20N4O5/c17-14(21)10-25-12-4-1-3-11(7-12)8-19-20-16(23)15(22)18-9-13-5-2-6-24-13/h1,3-4,7-8,13H,2,5-6,9-10H2,(H2,17,21)(H,18,22)(H,20,23)/b19-8-/t13-/m0/s1 |
| InChIKey | NTXFJINASOUARC-YPPWBJDHSA-N |
| XLogP | -0.70 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|