C14H18N4O4 — CID 8990323
N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-propyloxamide (PubChem CID 8990323) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-propyloxamide.
| Compound Name | N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-propyloxamide |
|---|---|
| PubChem CID | 8990323 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N'-[(Z)-[3-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)N/N=C\c1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C14H18N4O4/c1-2-6-16-13(20)14(21)18-17-8-10-4-3-5-11(7-10)22-9-12(15)19/h3-5,7-8H,2,6,9H2,1H3,(H2,15,19)(H,16,20)(H,18,21)/b17-8- |
| InChIKey | IALKBRXYMOLUCV-IUXPMGMMSA-N |
| XLogP | -0.47 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|