C14H16N3O5- — CID 8989742
2-[4-[(Z)-[[2-oxo-2-(propylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 8989742) has the molecular formula C14H16N3O5- and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-[4-[(Z)-[[2-oxo-2-(propylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-[[2-oxo-2-(propylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8989742 |
| Molecular Formula | C14H16N3O5- |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[4-[(Z)-[[2-oxo-2-(propylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCCNC(=O)C(=O)N/N=C\c1ccc(OCC(=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O5/c1-2-7-15-13(20)14(21)17-16-8-10-3-5-11(6-4-10)22-9-12(18)19/h3-6,8H,2,7,9H2,1H3,(H,15,20)(H,17,21)(H,18,19)/p-1/b16-8- |
| InChIKey | MHUCZTQYEUWIAR-PXNMLYILSA-M |
| XLogP | -1.21 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|