C13H14F3N3O2 — CID 126006156
N-propyl-N'-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide (PubChem CID 126006156) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is N-propyl-N'-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide.
| Compound Name | N-propyl-N'-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126006156 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-propyl-N'-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]oxamide |
| SMILES | CCCNC(=O)C(=O)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O2/c1-2-7-17-11(20)12(21)19-18-8-9-3-5-10(6-4-9)13(14,15)16/h3-6,8H,2,7H2,1H3,(H,17,20)(H,19,21)/b18-8- |
| InChIKey | UVLLXADGXSTYRD-LSCVHKIXSA-N |
| XLogP | 1.68 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|